C27H36Cl2F2N4O — CID 163534701
(6R)-6-[(1R,3aS,4E,7aR)-4-[2-[5-(3,5-dichlorophenyl)tetrazol-2-yl]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3,3-difluoro-2-methylheptan-2-ol (PubChem CID 163534701) has the molecular formula C27H36Cl2F2N4O and a molecular weight of 541.51 g/mol. Its IUPAC name is (6R)-6-[(1R,3aS,4E,7aR)-4-[2-[5-(3,5-dichlorophenyl)tetrazol-2-yl]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3,3-difluoro-2-methylheptan-2-ol.
| Compound Name | (6R)-6-[(1R,3aS,4E,7aR)-4-[2-[5-(3,5-dichlorophenyl)tetrazol-2-yl]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3,3-difluoro-2-methylheptan-2-ol |
|---|---|
| PubChem CID | 163534701 |
| Molecular Formula | C27H36Cl2F2N4O |
| Molecular Weight | 541.51 g/mol |
| Exact Mass | 540.22 |
| IUPAC Name | (6R)-6-[(1R,3aS,4E,7aR)-4-[2-[5-(3,5-dichlorophenyl)tetrazol-2-yl]ethylidene]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-3,3-difluoro-2-methylheptan-2-ol |
| SMILES | C[C@H](CCC(F)(F)C(C)(C)O)[C@H]1CC[C@H]2/C(=C/Cn3nnc(-c4cc(Cl)cc(Cl)c4)n3)CCC[C@]12C |
| InChI | InChI=1S/C27H36Cl2F2N4O/c1-17(9-12-27(30,31)25(2,3)36)22-7-8-23-18(6-5-11-26(22,23)4)10-13-35-33-24(32-34-35)19-14-20(28)16-21(29)15-19/h10,14-17,22-23,36H,5-9,11-13H2,1-4H3/b18-10+/t17-,22-,23+,26-/m1/s1 |
| InChIKey | DVYVGEKYJBUWDH-VYDFOMHYSA-N |
| XLogP | 7.61 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.51 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|