About 4-(1-ethyl-4-methylpyrazol-5-yl)-3-methyl-1,2-oxazole
4-(1-ethyl-4-methylpyrazol-5-yl)-3-methyl-1,2-oxazole (PubChem CID 163535094) has the molecular formula C10H13N3O
and a molecular weight of 191.23 g/mol. Its IUPAC name is 4-(1-ethyl-4-methylpyrazol-5-yl)-3-methyl-1,2-oxazole.
Analyze 4-(1-ethyl-4-methylpyrazol-5-yl)-3-methyl-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-ethyl-4-methylpyrazol-5-yl)-3-methyl-1,2-oxazole?
The IUPAC name of 4-(1-ethyl-4-methylpyrazol-5-yl)-3-methyl-1,2-oxazole (CID 163535094) is 4-(1-ethyl-4-methylpyrazol-5-yl)-3-methyl-1,2-oxazole.
What is the SMILES notation for 4-(1-ethyl-4-methylpyrazol-5-yl)-3-methyl-1,2-oxazole?
The canonical SMILES for 4-(1-ethyl-4-methylpyrazol-5-yl)-3-methyl-1,2-oxazole is CCn1ncc(C)c1-c1conc1C.
What is the InChIKey of 4-(1-ethyl-4-methylpyrazol-5-yl)-3-methyl-1,2-oxazole?
The InChIKey is DWGFXQMWGAZIQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O/c1-4-13-10(7(2)5-11-13)9-6-14-12-8(9)3/h5-6H,4H2,1-3H3.
What are the key properties of 4-(1-ethyl-4-methylpyrazol-5-yl)-3-methyl-1,2-oxazole?
4-(1-ethyl-4-methylpyrazol-5-yl)-3-methyl-1,2-oxazole has a molecular weight of 191.23 g/mol, XLogP of 2.17, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-ethyl-4-methylpyrazol-5-yl)-3-methyl-1,2-oxazole is sourced from PubChem (CID 163535094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).