About 2-[[4-[4-[methyl(diphenyl)-λ4-sulfanyl]phenyl]-1-adamantyl]oxy]-2-oxoacetate
2-[[4-[4-[methyl(diphenyl)-λ4-sulfanyl]phenyl]-1-adamantyl]oxy]-2-oxoacetate (PubChem CID 163535320) has the molecular formula C31H31O4S-
and a molecular weight of 499.65 g/mol. Its IUPAC name is 2-[[4-[4-[methyl(diphenyl)-λ4-sulfanyl]phenyl]-1-adamantyl]oxy]-2-oxoacetate.
Molecular Properties
| Compound Name | 2-[[4-[4-[methyl(diphenyl)-λ4-sulfanyl]phenyl]-1-adamantyl]oxy]-2-oxoacetate |
| PubChem CID | 163535320 |
| Molecular Formula | C31H31O4S- |
| Molecular Weight | 499.65 g/mol |
| Exact Mass | 499.19 |
| IUPAC Name | 2-[[4-[4-[methyl(diphenyl)-λ4-sulfanyl]phenyl]-1-adamantyl]oxy]-2-oxoacetate |
| SMILES | CS(c1ccccc1)(c1ccccc1)c1ccc(C2C3CC4CC2CC(OC(=O)C(=O)[O-])(C4)C3)cc1 |
| InChI | InChI=1S/C31H32O4S/c1-36(25-8-4-2-5-9-25,26-10-6-3-7-11-26)27-14-12-22(13-15-27)28-23-16-21-17-24(28)20-31(18-21,19-23)35-30(34)29(32)33/h2-15,21,23-24,28H,16-20H2,1H3,(H,32,33)/p-1 |
| InChIKey | DWLKURDBJKIFII-UHFFFAOYSA-M |
| XLogP | 5.55 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 499.65 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[[4-[4-[methyl(diphenyl)-λ4-sulfanyl]phenyl]-1-adamantyl]oxy]-2-oxoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[4-[4-[methyl(diphenyl)-λ4-sulfanyl]phenyl]-1-adamantyl]oxy]-2-oxoacetate?
The IUPAC name of 2-[[4-[4-[methyl(diphenyl)-λ4-sulfanyl]phenyl]-1-adamantyl]oxy]-2-oxoacetate (CID 163535320) is 2-[[4-[4-[methyl(diphenyl)-λ4-sulfanyl]phenyl]-1-adamantyl]oxy]-2-oxoacetate.
What is the SMILES notation for 2-[[4-[4-[methyl(diphenyl)-λ4-sulfanyl]phenyl]-1-adamantyl]oxy]-2-oxoacetate?
The canonical SMILES for 2-[[4-[4-[methyl(diphenyl)-λ4-sulfanyl]phenyl]-1-adamantyl]oxy]-2-oxoacetate is CS(c1ccccc1)(c1ccccc1)c1ccc(C2C3CC4CC2CC(OC(=O)C(=O)[O-])(C4)C3)cc1.
What is the InChIKey of 2-[[4-[4-[methyl(diphenyl)-λ4-sulfanyl]phenyl]-1-adamantyl]oxy]-2-oxoacetate?
The InChIKey is DWLKURDBJKIFII-UHFFFAOYSA-M. The full InChI is InChI=1S/C31H32O4S/c1-36(25-8-4-2-5-9-25,26-10-6-3-7-11-26)27-14-12-22(13-15-27)28-23-16-21-17-24(28)20-31(18-21,19-23)35-30(34)29(32)33/h2-15,21,23-24,28H,16-20H2,1H3,(H,32,33)/p-1.
What are the key properties of 2-[[4-[4-[methyl(diphenyl)-λ4-sulfanyl]phenyl]-1-adamantyl]oxy]-2-oxoacetate?
2-[[4-[4-[methyl(diphenyl)-λ4-sulfanyl]phenyl]-1-adamantyl]oxy]-2-oxoacetate has a molecular weight of 499.65 g/mol, XLogP of 5.55, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[4-[4-[methyl(diphenyl)-λ4-sulfanyl]phenyl]-1-adamantyl]oxy]-2-oxoacetate is sourced from PubChem (CID 163535320), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).