About 1-cyclohexylpenta-1,3-dienylcyclohexane;phenol
1-cyclohexylpenta-1,3-dienylcyclohexane;phenol (PubChem CID 163535373) has the molecular formula C23H34O
and a molecular weight of 326.52 g/mol. Its IUPAC name is 1-cyclohexylpenta-1,3-dienylcyclohexane;phenol.
Molecular Properties
| Compound Name | 1-cyclohexylpenta-1,3-dienylcyclohexane;phenol |
| PubChem CID | 163535373 |
| Molecular Formula | C23H34O |
| Molecular Weight | 326.52 g/mol |
| Exact Mass | 326.26 |
| IUPAC Name | 1-cyclohexylpenta-1,3-dienylcyclohexane;phenol |
| SMILES | CC=CC=C(C1CCCCC1)C1CCCCC1.Oc1ccccc1 |
| InChI | InChI=1S/C17H28.C6H6O/c1-2-3-14-17(15-10-6-4-7-11-15)16-12-8-5-9-13-16;7-6-4-2-1-3-5-6/h2-3,14-16H,4-13H2,1H3;1-5,7H |
| InChIKey | DWMSGJCAVHKMPU-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 326.52 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexylpenta-1,3-dienylcyclohexane;phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexylpenta-1,3-dienylcyclohexane;phenol?
The IUPAC name of 1-cyclohexylpenta-1,3-dienylcyclohexane;phenol (CID 163535373) is 1-cyclohexylpenta-1,3-dienylcyclohexane;phenol.
What is the SMILES notation for 1-cyclohexylpenta-1,3-dienylcyclohexane;phenol?
The canonical SMILES for 1-cyclohexylpenta-1,3-dienylcyclohexane;phenol is CC=CC=C(C1CCCCC1)C1CCCCC1.Oc1ccccc1.
What is the InChIKey of 1-cyclohexylpenta-1,3-dienylcyclohexane;phenol?
The InChIKey is DWMSGJCAVHKMPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28.C6H6O/c1-2-3-14-17(15-10-6-4-7-11-15)16-12-8-5-9-13-16;7-6-4-2-1-3-5-6/h2-3,14-16H,4-13H2,1H3;1-5,7H.
What are the key properties of 1-cyclohexylpenta-1,3-dienylcyclohexane;phenol?
1-cyclohexylpenta-1,3-dienylcyclohexane;phenol has a molecular weight of 326.52 g/mol, XLogP of 7.04, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexylpenta-1,3-dienylcyclohexane;phenol is sourced from PubChem (CID 163535373), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).