C13H24FIN2O — CID 163535513
1-N-[(4E,6Z)-5-[fluoro(iodo)methoxy]octa-4,6-dienyl]-2-N-methylpropane-1,2-diamine (PubChem CID 163535513) has the molecular formula C13H24FIN2O and a molecular weight of 370.25 g/mol. Its IUPAC name is 1-N-[(4E,6Z)-5-[fluoro(iodo)methoxy]octa-4,6-dienyl]-2-N-methylpropane-1,2-diamine.
| Compound Name | 1-N-[(4E,6Z)-5-[fluoro(iodo)methoxy]octa-4,6-dienyl]-2-N-methylpropane-1,2-diamine |
|---|---|
| PubChem CID | 163535513 |
| Molecular Formula | C13H24FIN2O |
| Molecular Weight | 370.25 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 1-N-[(4E,6Z)-5-[fluoro(iodo)methoxy]octa-4,6-dienyl]-2-N-methylpropane-1,2-diamine |
| SMILES | C/C=C\C(=C/CCCNCC(C)NC)OC(F)I |
| InChI | InChI=1S/C13H24FIN2O/c1-4-7-12(18-13(14)15)8-5-6-9-17-10-11(2)16-3/h4,7-8,11,13,16-17H,5-6,9-10H2,1-3H3/b7-4-,12-8+ |
| InChIKey | DWPWYTHNDXCFSA-OTIJGBKASA-N |
| XLogP | 3.13 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.25 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|