C33H26N4 — CID 163535760
9-[3-(4-cyclohex-2-en-1-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]carbazole (PubChem CID 163535760) has the molecular formula C33H26N4 and a molecular weight of 478.60 g/mol. Its IUPAC name is 9-[3-(4-cyclohex-2-en-1-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]carbazole.
| Compound Name | 9-[3-(4-cyclohex-2-en-1-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]carbazole |
|---|---|
| PubChem CID | 163535760 |
| Molecular Formula | C33H26N4 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.22 |
| IUPAC Name | 9-[3-(4-cyclohex-2-en-1-yl-6-phenyl-1,3,5-triazin-2-yl)phenyl]carbazole |
| SMILES | C1=CC(c2nc(-c3ccccc3)nc(-c3cccc(-n4c5ccccc5c5ccccc54)c3)n2)CCC1 |
| InChI | InChI=1S/C33H26N4/c1-3-12-23(13-4-1)31-34-32(24-14-5-2-6-15-24)36-33(35-31)25-16-11-17-26(22-25)37-29-20-9-7-18-27(29)28-19-8-10-21-30(28)37/h1,3-5,7-14,16-22,24H,2,6,15H2 |
| InChIKey | DWVBRKRVDMMUMR-UHFFFAOYSA-N |
| XLogP | 8.13 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|