C27H34F6N4O — CID 163536279
(6R)-6-[(1R,3aS,4E,7aR)-7a-methyl-4-[2-(5-phenyltetrazol-2-yl)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-1,1,1-trifluoro-2-(trifluoromethyl)heptan-2-ol (PubChem CID 163536279) has the molecular formula C27H34F6N4O and a molecular weight of 544.58 g/mol. Its IUPAC name is (6R)-6-[(1R,3aS,4E,7aR)-7a-methyl-4-[2-(5-phenyltetrazol-2-yl)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-1,1,1-trifluoro-2-(trifluoromethyl)heptan-2-ol.
| Compound Name | (6R)-6-[(1R,3aS,4E,7aR)-7a-methyl-4-[2-(5-phenyltetrazol-2-yl)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-1,1,1-trifluoro-2-(trifluoromethyl)heptan-2-ol |
|---|---|
| PubChem CID | 163536279 |
| Molecular Formula | C27H34F6N4O |
| Molecular Weight | 544.58 g/mol |
| Exact Mass | 544.26 |
| IUPAC Name | (6R)-6-[(1R,3aS,4E,7aR)-7a-methyl-4-[2-(5-phenyltetrazol-2-yl)ethylidene]-2,3,3a,5,6,7-hexahydro-1H-inden-1-yl]-1,1,1-trifluoro-2-(trifluoromethyl)heptan-2-ol |
| SMILES | C[C@H](CCCC(O)(C(F)(F)F)C(F)(F)F)[C@H]1CC[C@H]2/C(=C/Cn3nnc(-c4ccccc4)n3)CCC[C@]12C |
| InChI | InChI=1S/C27H34F6N4O/c1-18(8-6-16-25(38,26(28,29)30)27(31,32)33)21-12-13-22-19(11-7-15-24(21,22)2)14-17-37-35-23(34-36-37)20-9-4-3-5-10-20/h3-5,9-10,14,18,21-22,38H,6-8,11-13,15-17H2,1-2H3/b19-14+/t18-,21-,22+,24-/m1/s1 |
| InChIKey | LYHSZIOXGYKRMG-JFYYGKOMSA-N |
| XLogP | 7.14 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.58 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|