About 4,10-dioxa-3-thiatricyclo[5.2.1.02,6]decan-5-one
4,10-dioxa-3-thiatricyclo[5.2.1.02,6]decan-5-one (PubChem CID 163536299) has the molecular formula C7H8O3S
and a molecular weight of 172.20 g/mol. Its IUPAC name is 4,10-dioxa-3-thiatricyclo[5.2.1.02,6]decan-5-one.
Molecular Properties
| Compound Name | 4,10-dioxa-3-thiatricyclo[5.2.1.02,6]decan-5-one |
| PubChem CID | 163536299 |
| Molecular Formula | C7H8O3S |
| Molecular Weight | 172.20 g/mol |
| Exact Mass | 172.02 |
| IUPAC Name | 4,10-dioxa-3-thiatricyclo[5.2.1.02,6]decan-5-one |
| SMILES | O=C1OSC2C3CCC(O3)C12 |
| InChI | InChI=1S/C7H8O3S/c8-7-5-3-1-2-4(9-3)6(5)11-10-7/h3-6H,1-2H2 |
| InChIKey | DXGOERBZIYNSCI-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.20 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4,10-dioxa-3-thiatricyclo[5.2.1.02,6]decan-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,10-dioxa-3-thiatricyclo[5.2.1.02,6]decan-5-one?
The IUPAC name of 4,10-dioxa-3-thiatricyclo[5.2.1.02,6]decan-5-one (CID 163536299) is 4,10-dioxa-3-thiatricyclo[5.2.1.02,6]decan-5-one.
What is the SMILES notation for 4,10-dioxa-3-thiatricyclo[5.2.1.02,6]decan-5-one?
The canonical SMILES for 4,10-dioxa-3-thiatricyclo[5.2.1.02,6]decan-5-one is O=C1OSC2C3CCC(O3)C12.
What is the InChIKey of 4,10-dioxa-3-thiatricyclo[5.2.1.02,6]decan-5-one?
The InChIKey is DXGOERBZIYNSCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O3S/c8-7-5-3-1-2-4(9-3)6(5)11-10-7/h3-6H,1-2H2.
What are the key properties of 4,10-dioxa-3-thiatricyclo[5.2.1.02,6]decan-5-one?
4,10-dioxa-3-thiatricyclo[5.2.1.02,6]decan-5-one has a molecular weight of 172.20 g/mol, XLogP of 0.74, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4,10-dioxa-3-thiatricyclo[5.2.1.02,6]decan-5-one is sourced from PubChem (CID 163536299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).