C19H28F2O10S — CID 163536689
1,1-difluoro-2-[4-[[2-(3-hydroxypentan-3-yl)-7-oxo-6-oxabicyclo[3.2.1]octan-4-yl]oxy]-4-oxobutanoyl]oxypropane-1-sulfonic acid (PubChem CID 163536689) has the molecular formula C19H28F2O10S and a molecular weight of 486.49 g/mol. Its IUPAC name is 1,1-difluoro-2-[4-[[2-(3-hydroxypentan-3-yl)-7-oxo-6-oxabicyclo[3.2.1]octan-4-yl]oxy]-4-oxobutanoyl]oxypropane-1-sulfonic acid.
| Compound Name | 1,1-difluoro-2-[4-[[2-(3-hydroxypentan-3-yl)-7-oxo-6-oxabicyclo[3.2.1]octan-4-yl]oxy]-4-oxobutanoyl]oxypropane-1-sulfonic acid |
|---|---|
| PubChem CID | 163536689 |
| Molecular Formula | C19H28F2O10S |
| Molecular Weight | 486.49 g/mol |
| Exact Mass | 486.14 |
| IUPAC Name | 1,1-difluoro-2-[4-[[2-(3-hydroxypentan-3-yl)-7-oxo-6-oxabicyclo[3.2.1]octan-4-yl]oxy]-4-oxobutanoyl]oxypropane-1-sulfonic acid |
| SMILES | CCC(O)(CC)C1CC(OC(=O)CCC(=O)OC(C)C(F)(F)S(=O)(=O)O)C2CC1C(=O)O2 |
| InChI | InChI=1S/C19H28F2O10S/c1-4-18(25,5-2)12-9-14(13-8-11(12)17(24)31-13)30-16(23)7-6-15(22)29-10(3)19(20,21)32(26,27)28/h10-14,25H,4-9H2,1-3H3,(H,26,27,28) |
| InChIKey | XRAYKDOLRGHZGA-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 153.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.49 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|