C37H42O6S — CID 163536693
ethyl 2-(3-cyclopropyl-4-cyclopropylsulfonylphenyl)-4-[(2S,3S,8R)-2,3-diphenyl-1,4-dioxaspiro[4.4]nonan-8-yl]butanoate (PubChem CID 163536693) has the molecular formula C37H42O6S and a molecular weight of 614.80 g/mol. Its IUPAC name is ethyl 2-(3-cyclopropyl-4-cyclopropylsulfonylphenyl)-4-[(2S,3S,8R)-2,3-diphenyl-1,4-dioxaspiro[4.4]nonan-8-yl]butanoate.
| Compound Name | ethyl 2-(3-cyclopropyl-4-cyclopropylsulfonylphenyl)-4-[(2S,3S,8R)-2,3-diphenyl-1,4-dioxaspiro[4.4]nonan-8-yl]butanoate |
|---|---|
| PubChem CID | 163536693 |
| Molecular Formula | C37H42O6S |
| Molecular Weight | 614.80 g/mol |
| Exact Mass | 614.27 |
| IUPAC Name | ethyl 2-(3-cyclopropyl-4-cyclopropylsulfonylphenyl)-4-[(2S,3S,8R)-2,3-diphenyl-1,4-dioxaspiro[4.4]nonan-8-yl]butanoate |
| SMILES | CCOC(=O)C(CC[C@@H]1CCC2(C1)O[C@@H](c1ccccc1)[C@H](c1ccccc1)O2)c1ccc(S(=O)(=O)C2CC2)c(C2CC2)c1 |
| InChI | InChI=1S/C37H42O6S/c1-2-41-36(38)31(29-16-20-33(32(23-29)26-14-15-26)44(39,40)30-17-18-30)19-13-25-21-22-37(24-25)42-34(27-9-5-3-6-10-27)35(43-37)28-11-7-4-8-12-28/h3-12,16,20,23,25-26,30-31,34-35H,2,13-15,17-19,21-22,24H2,1H3/t25-,31?,34+,35+/m1/s1 |
| InChIKey | DXPJXPUHUALNPS-LHEPEGSUSA-N |
| XLogP | 7.95 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.80 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |