C13H24N3O3+ — CID 163537220
[1-[[4-(2-carboxyethyl)piperidine-1-carbonyl]amino]-2-methylpropylidene]azanium (PubChem CID 163537220) has the molecular formula C13H24N3O3+ and a molecular weight of 270.35 g/mol. Its IUPAC name is [1-[[4-(2-carboxyethyl)piperidine-1-carbonyl]amino]-2-methylpropylidene]azanium.
| Compound Name | [1-[[4-(2-carboxyethyl)piperidine-1-carbonyl]amino]-2-methylpropylidene]azanium |
|---|---|
| PubChem CID | 163537220 |
| Molecular Formula | C13H24N3O3+ |
| Molecular Weight | 270.35 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | [1-[[4-(2-carboxyethyl)piperidine-1-carbonyl]amino]-2-methylpropylidene]azanium |
| SMILES | CC(C)C(=[NH2+])NC(=O)N1CCC(CCC(=O)O)CC1 |
| InChI | InChI=1S/C13H23N3O3/c1-9(2)12(14)15-13(19)16-7-5-10(6-8-16)3-4-11(17)18/h9-10H,3-8H2,1-2H3,(H,17,18)(H2,14,15,19)/p+1 |
| InChIKey | DYADEVBUPCABIA-UHFFFAOYSA-O |
| XLogP | 0.09 |
| TPSA | 95.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.35 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|