About 2-methyl-7λ3-ioda-9-oxabicyclo[4.3.0]nona-1,3,5,7-tetraene
2-methyl-7λ3-ioda-9-oxabicyclo[4.3.0]nona-1,3,5,7-tetraene (PubChem CID 163537485) has the molecular formula C8H7IO
and a molecular weight of 246.05 g/mol. Its IUPAC name is 2-methyl-7λ3-ioda-9-oxabicyclo[4.3.0]nona-1,3,5,7-tetraene.
Molecular Properties
| Compound Name | 2-methyl-7λ3-ioda-9-oxabicyclo[4.3.0]nona-1,3,5,7-tetraene |
| PubChem CID | 163537485 |
| Molecular Formula | C8H7IO |
| Molecular Weight | 246.05 g/mol |
| Exact Mass | 245.95 |
| IUPAC Name | 2-methyl-7λ3-ioda-9-oxabicyclo[4.3.0]nona-1,3,5,7-tetraene |
| SMILES | Cc1cccc2c1OC=I2 |
| InChI | InChI=1S/C8H7IO/c1-6-3-2-4-7-8(6)10-5-9-7/h2-5H,1H3 |
| InChIKey | DYGARLDTSWQFAZ-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.05 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-7λ3-ioda-9-oxabicyclo[4.3.0]nona-1,3,5,7-tetraene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-7λ3-ioda-9-oxabicyclo[4.3.0]nona-1,3,5,7-tetraene?
The IUPAC name of 2-methyl-7λ3-ioda-9-oxabicyclo[4.3.0]nona-1,3,5,7-tetraene (CID 163537485) is 2-methyl-7λ3-ioda-9-oxabicyclo[4.3.0]nona-1,3,5,7-tetraene.
What is the SMILES notation for 2-methyl-7λ3-ioda-9-oxabicyclo[4.3.0]nona-1,3,5,7-tetraene?
The canonical SMILES for 2-methyl-7λ3-ioda-9-oxabicyclo[4.3.0]nona-1,3,5,7-tetraene is Cc1cccc2c1OC=I2.
What is the InChIKey of 2-methyl-7λ3-ioda-9-oxabicyclo[4.3.0]nona-1,3,5,7-tetraene?
The InChIKey is DYGARLDTSWQFAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7IO/c1-6-3-2-4-7-8(6)10-5-9-7/h2-5H,1H3.
What are the key properties of 2-methyl-7λ3-ioda-9-oxabicyclo[4.3.0]nona-1,3,5,7-tetraene?
2-methyl-7λ3-ioda-9-oxabicyclo[4.3.0]nona-1,3,5,7-tetraene has a molecular weight of 246.05 g/mol, XLogP of 2.29, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-7λ3-ioda-9-oxabicyclo[4.3.0]nona-1,3,5,7-tetraene is sourced from PubChem (CID 163537485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).