C18H22FN3O3 — CID 163538021
ethyl 2-(cyclopropyldiazenyl)-5-(dimethylamino)-4-(4-fluorophenyl)-3-hydroxypenta-2,4-dienoate (PubChem CID 163538021) has the molecular formula C18H22FN3O3 and a molecular weight of 347.39 g/mol. Its IUPAC name is ethyl 2-(cyclopropyldiazenyl)-5-(dimethylamino)-4-(4-fluorophenyl)-3-hydroxypenta-2,4-dienoate.
| Compound Name | ethyl 2-(cyclopropyldiazenyl)-5-(dimethylamino)-4-(4-fluorophenyl)-3-hydroxypenta-2,4-dienoate |
|---|---|
| PubChem CID | 163538021 |
| Molecular Formula | C18H22FN3O3 |
| Molecular Weight | 347.39 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | ethyl 2-(cyclopropyldiazenyl)-5-(dimethylamino)-4-(4-fluorophenyl)-3-hydroxypenta-2,4-dienoate |
| SMILES | CCOC(=O)C(/N=N/C1CC1)=C(O)C(=CN(C)C)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H22FN3O3/c1-4-25-18(24)16(21-20-14-9-10-14)17(23)15(11-22(2)3)12-5-7-13(19)8-6-12/h5-8,11,14,23H,4,9-10H2,1-3H3/b15-11?,17-16?,21-20+ |
| InChIKey | MORQRNZHFXWTET-OLZUJWBBSA-N |
| XLogP | 3.68 |
| TPSA | 74.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.39 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|