About N-methyl-3-methylidene-4H-1,4-benzoxazin-8-amine
N-methyl-3-methylidene-4H-1,4-benzoxazin-8-amine (PubChem CID 163538090) has the molecular formula C10H12N2O
and a molecular weight of 176.22 g/mol. Its IUPAC name is N-methyl-3-methylidene-4H-1,4-benzoxazin-8-amine.
Molecular Properties
| Compound Name | N-methyl-3-methylidene-4H-1,4-benzoxazin-8-amine |
| PubChem CID | 163538090 |
| Molecular Formula | C10H12N2O |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | N-methyl-3-methylidene-4H-1,4-benzoxazin-8-amine |
| SMILES | C=C1COc2c(NC)cccc2N1 |
| InChI | InChI=1S/C10H12N2O/c1-7-6-13-10-8(11-2)4-3-5-9(10)12-7/h3-5,11-12H,1,6H2,2H3 |
| InChIKey | DYSKCBXWYURIRH-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-methyl-3-methylidene-4H-1,4-benzoxazin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-3-methylidene-4H-1,4-benzoxazin-8-amine?
The IUPAC name of N-methyl-3-methylidene-4H-1,4-benzoxazin-8-amine (CID 163538090) is N-methyl-3-methylidene-4H-1,4-benzoxazin-8-amine.
What is the SMILES notation for N-methyl-3-methylidene-4H-1,4-benzoxazin-8-amine?
The canonical SMILES for N-methyl-3-methylidene-4H-1,4-benzoxazin-8-amine is C=C1COc2c(NC)cccc2N1.
What is the InChIKey of N-methyl-3-methylidene-4H-1,4-benzoxazin-8-amine?
The InChIKey is DYSKCBXWYURIRH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12N2O/c1-7-6-13-10-8(11-2)4-3-5-9(10)12-7/h3-5,11-12H,1,6H2,2H3.
What are the key properties of N-methyl-3-methylidene-4H-1,4-benzoxazin-8-amine?
N-methyl-3-methylidene-4H-1,4-benzoxazin-8-amine has a molecular weight of 176.22 g/mol, XLogP of 2.05, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-3-methylidene-4H-1,4-benzoxazin-8-amine is sourced from PubChem (CID 163538090), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).