C19H24FN5O — CID 163538424
6-[[(1R)-2-aminocyclohexyl]amino]-5-fluoro-2-(3-methylanilino)pyridine-3-carboxamide (PubChem CID 163538424) has the molecular formula C19H24FN5O and a molecular weight of 357.43 g/mol. Its IUPAC name is 6-[[(1R)-2-aminocyclohexyl]amino]-5-fluoro-2-(3-methylanilino)pyridine-3-carboxamide.
| Compound Name | 6-[[(1R)-2-aminocyclohexyl]amino]-5-fluoro-2-(3-methylanilino)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 163538424 |
| Molecular Formula | C19H24FN5O |
| Molecular Weight | 357.43 g/mol |
| Exact Mass | 357.20 |
| IUPAC Name | 6-[[(1R)-2-aminocyclohexyl]amino]-5-fluoro-2-(3-methylanilino)pyridine-3-carboxamide |
| SMILES | Cc1cccc(Nc2nc(N[C@@H]3CCCCC3N)c(F)cc2C(N)=O)c1 |
| InChI | InChI=1S/C19H24FN5O/c1-11-5-4-6-12(9-11)23-18-13(17(22)26)10-14(20)19(25-18)24-16-8-3-2-7-15(16)21/h4-6,9-10,15-16H,2-3,7-8,21H2,1H3,(H2,22,26)(H2,23,24,25)/t15?,16-/m1/s1 |
| InChIKey | DYZICFZHDDMDJF-OEMAIJDKSA-N |
| XLogP | 3.05 |
| TPSA | 106.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.43 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |