C34H37N3O8 — CID 163538755
(2R,3R)-2,3-bis[(4-methylbenzoyl)oxy]butanedioic acid;(10R,15S)-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene (PubChem CID 163538755) has the molecular formula C34H37N3O8 and a molecular weight of 615.68 g/mol. Its IUPAC name is (2R,3R)-2,3-bis[(4-methylbenzoyl)oxy]butanedioic acid;(10R,15S)-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene.
| Compound Name | (2R,3R)-2,3-bis[(4-methylbenzoyl)oxy]butanedioic acid;(10R,15S)-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene |
|---|---|
| PubChem CID | 163538755 |
| Molecular Formula | C34H37N3O8 |
| Molecular Weight | 615.68 g/mol |
| Exact Mass | 615.26 |
| IUPAC Name | (2R,3R)-2,3-bis[(4-methylbenzoyl)oxy]butanedioic acid;(10R,15S)-4-methyl-1,4,12-triazatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16)-triene |
| SMILES | CN1CCN2c3c(cccc31)[C@@H]1CNCC[C@@H]12.Cc1ccc(C(=O)O[C@@H](C(=O)O)[C@@H](OC(=O)c2ccc(C)cc2)C(=O)O)cc1 |
| InChI | InChI=1S/C20H18O8.C14H19N3/c1-11-3-7-13(8-4-11)19(25)27-15(17(21)22)16(18(23)24)28-20(26)14-9-5-12(2)6-10-14;1-16-7-8-17-12-5-6-15-9-11(12)10-3-2-4-13(16)14(10)17/h3-10,15-16H,1-2H3,(H,21,22)(H,23,24);2-4,11-12,15H,5-9H2,1H3/t15-,16-;11-,12-/m10/s1 |
| InChIKey | DZGCHZSLYJIVKC-JPSYZCRXSA-N |
| XLogP | 3.63 |
| TPSA | 145.71 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.68 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |