C10H18IN3O2 — CID 163538785
(3S,4R)-4-amino-3-iodo-N-methyl-5-oxo-5-pyrrolidin-1-ylpentanamide (PubChem CID 163538785) has the molecular formula C10H18IN3O2 and a molecular weight of 339.18 g/mol. Its IUPAC name is (3S,4R)-4-amino-3-iodo-N-methyl-5-oxo-5-pyrrolidin-1-ylpentanamide.
| Compound Name | (3S,4R)-4-amino-3-iodo-N-methyl-5-oxo-5-pyrrolidin-1-ylpentanamide |
|---|---|
| PubChem CID | 163538785 |
| Molecular Formula | C10H18IN3O2 |
| Molecular Weight | 339.18 g/mol |
| Exact Mass | 339.04 |
| IUPAC Name | (3S,4R)-4-amino-3-iodo-N-methyl-5-oxo-5-pyrrolidin-1-ylpentanamide |
| SMILES | CNC(=O)C[C@H](I)[C@H](N)C(=O)N1CCCC1 |
| InChI | InChI=1S/C10H18IN3O2/c1-13-8(15)6-7(11)9(12)10(16)14-4-2-3-5-14/h7,9H,2-6,12H2,1H3,(H,13,15)/t7-,9-/m0/s1 |
| InChIKey | DZGVAFPKAVSWRZ-CBAPKCEASA-N |
| XLogP | -0.12 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.18 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|