About 3-[(1Z)-buta-1,3-dienyl]-1-ethyl-1-[(Z)-prop-1-enyl]cyclopentane
3-[(1Z)-buta-1,3-dienyl]-1-ethyl-1-[(Z)-prop-1-enyl]cyclopentane (PubChem CID 163539203) has the molecular formula C14H22
and a molecular weight of 190.33 g/mol. Its IUPAC name is 3-[(1Z)-buta-1,3-dienyl]-1-ethyl-1-[(Z)-prop-1-enyl]cyclopentane.
Molecular Properties
| Compound Name | 3-[(1Z)-buta-1,3-dienyl]-1-ethyl-1-[(Z)-prop-1-enyl]cyclopentane |
| PubChem CID | 163539203 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | 3-[(1Z)-buta-1,3-dienyl]-1-ethyl-1-[(Z)-prop-1-enyl]cyclopentane |
| SMILES | C=C/C=C\C1CCC(/C=C\C)(CC)C1 |
| InChI | InChI=1S/C14H22/c1-4-7-8-13-9-11-14(6-3,12-13)10-5-2/h4-5,7-8,10,13H,1,6,9,11-12H2,2-3H3/b8-7-,10-5- |
| InChIKey | DZPIMHKPVXTDLH-JCPYGFQFSA-N |
| XLogP | 4.50 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 3-[(1Z)-buta-1,3-dienyl]-1-ethyl-1-[(Z)-prop-1-enyl]cyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(1Z)-buta-1,3-dienyl]-1-ethyl-1-[(Z)-prop-1-enyl]cyclopentane?
The IUPAC name of 3-[(1Z)-buta-1,3-dienyl]-1-ethyl-1-[(Z)-prop-1-enyl]cyclopentane (CID 163539203) is 3-[(1Z)-buta-1,3-dienyl]-1-ethyl-1-[(Z)-prop-1-enyl]cyclopentane.
What is the SMILES notation for 3-[(1Z)-buta-1,3-dienyl]-1-ethyl-1-[(Z)-prop-1-enyl]cyclopentane?
The canonical SMILES for 3-[(1Z)-buta-1,3-dienyl]-1-ethyl-1-[(Z)-prop-1-enyl]cyclopentane is C=C/C=C\C1CCC(/C=C\C)(CC)C1.
What is the InChIKey of 3-[(1Z)-buta-1,3-dienyl]-1-ethyl-1-[(Z)-prop-1-enyl]cyclopentane?
The InChIKey is DZPIMHKPVXTDLH-JCPYGFQFSA-N. The full InChI is InChI=1S/C14H22/c1-4-7-8-13-9-11-14(6-3,12-13)10-5-2/h4-5,7-8,10,13H,1,6,9,11-12H2,2-3H3/b8-7-,10-5-.
What are the key properties of 3-[(1Z)-buta-1,3-dienyl]-1-ethyl-1-[(Z)-prop-1-enyl]cyclopentane?
3-[(1Z)-buta-1,3-dienyl]-1-ethyl-1-[(Z)-prop-1-enyl]cyclopentane has a molecular weight of 190.33 g/mol, XLogP of 4.50, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(1Z)-buta-1,3-dienyl]-1-ethyl-1-[(Z)-prop-1-enyl]cyclopentane is sourced from PubChem (CID 163539203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).