About N-(C-chloro-N-methylcarbonimidoyl)-N'-propan-2-ylcarbamimidoyl chloride
N-(C-chloro-N-methylcarbonimidoyl)-N'-propan-2-ylcarbamimidoyl chloride (PubChem CID 163539624) has the molecular formula C6H11Cl2N3
and a molecular weight of 196.08 g/mol. Its IUPAC name is N-(C-chloro-N-methylcarbonimidoyl)-N'-propan-2-ylcarbamimidoyl chloride.
Molecular Properties
| Compound Name | N-(C-chloro-N-methylcarbonimidoyl)-N'-propan-2-ylcarbamimidoyl chloride |
| PubChem CID | 163539624 |
| Molecular Formula | C6H11Cl2N3 |
| Molecular Weight | 196.08 g/mol |
| Exact Mass | 195.03 |
| IUPAC Name | N-(C-chloro-N-methylcarbonimidoyl)-N'-propan-2-ylcarbamimidoyl chloride |
| SMILES | C/N=C(\Cl)N/C(Cl)=N/C(C)C |
| InChI | InChI=1S/C6H11Cl2N3/c1-4(2)10-6(8)11-5(7)9-3/h4H,1-3H3,(H,9,10,11) |
| InChIKey | DZZWCNFALLLVTJ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.08 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-(C-chloro-N-methylcarbonimidoyl)-N'-propan-2-ylcarbamimidoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(C-chloro-N-methylcarbonimidoyl)-N'-propan-2-ylcarbamimidoyl chloride?
The IUPAC name of N-(C-chloro-N-methylcarbonimidoyl)-N'-propan-2-ylcarbamimidoyl chloride (CID 163539624) is N-(C-chloro-N-methylcarbonimidoyl)-N'-propan-2-ylcarbamimidoyl chloride.
What is the SMILES notation for N-(C-chloro-N-methylcarbonimidoyl)-N'-propan-2-ylcarbamimidoyl chloride?
The canonical SMILES for N-(C-chloro-N-methylcarbonimidoyl)-N'-propan-2-ylcarbamimidoyl chloride is C/N=C(\Cl)N/C(Cl)=N/C(C)C.
What is the InChIKey of N-(C-chloro-N-methylcarbonimidoyl)-N'-propan-2-ylcarbamimidoyl chloride?
The InChIKey is DZZWCNFALLLVTJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11Cl2N3/c1-4(2)10-6(8)11-5(7)9-3/h4H,1-3H3,(H,9,10,11).
What are the key properties of N-(C-chloro-N-methylcarbonimidoyl)-N'-propan-2-ylcarbamimidoyl chloride?
N-(C-chloro-N-methylcarbonimidoyl)-N'-propan-2-ylcarbamimidoyl chloride has a molecular weight of 196.08 g/mol, XLogP of 1.80, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(C-chloro-N-methylcarbonimidoyl)-N'-propan-2-ylcarbamimidoyl chloride is sourced from PubChem (CID 163539624), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).