C7H9F2NO — CID 163539633
3-(difluoromethoxy)cyclohexa-1,3-dien-1-amine (PubChem CID 163539633) has the molecular formula C7H9F2NO and a molecular weight of 161.15 g/mol. Its IUPAC name is 3-(difluoromethoxy)cyclohexa-1,3-dien-1-amine.
| Compound Name | 3-(difluoromethoxy)cyclohexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 163539633 |
| Molecular Formula | C7H9F2NO |
| Molecular Weight | 161.15 g/mol |
| Exact Mass | 161.07 |
| IUPAC Name | 3-(difluoromethoxy)cyclohexa-1,3-dien-1-amine |
| SMILES | NC1=CC(OC(F)F)=CCC1 |
| InChI | InChI=1S/C7H9F2NO/c8-7(9)11-6-3-1-2-5(10)4-6/h3-4,7H,1-2,10H2 |
| InChIKey | DZZYMOAXOYXUCL-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.15 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |