C10H9N3O — CID 163539764
14-oxa-3,4,13-triazatricyclo[7.3.1.12,5]tetradeca-1(12),2,4,9(13),10-pentaene (PubChem CID 163539764) has the molecular formula C10H9N3O and a molecular weight of 187.20 g/mol. Its IUPAC name is 14-oxa-3,4,13-triazatricyclo[7.3.1.12,5]tetradeca-1(12),2,4,9(13),10-pentaene.
| Compound Name | 14-oxa-3,4,13-triazatricyclo[7.3.1.12,5]tetradeca-1(12),2,4,9(13),10-pentaene |
|---|---|
| PubChem CID | 163539764 |
| Molecular Formula | C10H9N3O |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | 14-oxa-3,4,13-triazatricyclo[7.3.1.12,5]tetradeca-1(12),2,4,9(13),10-pentaene |
| SMILES | c1cc2nc(c1)-c1nnc(o1)CCC2 |
| InChI | InChI=1S/C10H9N3O/c1-3-7-4-2-6-9-12-13-10(14-9)8(5-1)11-7/h1,3,5H,2,4,6H2 |
| InChIKey | BNLDNPWQHUTMSG-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 51.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |