C29H16F9N — CID 163539907
1,3,14-trimethyl-8-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenyl]-8-azatetracyclo[7.5.1.02,7.013,15]pentadeca-2,4,6,9,11,13(15)-hexaene (PubChem CID 163539907) has the molecular formula C29H16F9N and a molecular weight of 549.44 g/mol. Its IUPAC name is 1,3,14-trimethyl-8-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenyl]-8-azatetracyclo[7.5.1.02,7.013,15]pentadeca-2,4,6,9,11,13(15)-hexaene.
| Compound Name | 1,3,14-trimethyl-8-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenyl]-8-azatetracyclo[7.5.1.02,7.013,15]pentadeca-2,4,6,9,11,13(15)-hexaene |
|---|---|
| PubChem CID | 163539907 |
| Molecular Formula | C29H16F9N |
| Molecular Weight | 549.44 g/mol |
| Exact Mass | 549.11 |
| IUPAC Name | 1,3,14-trimethyl-8-[2,3,5,6-tetrafluoro-4-(2,3,4,5,6-pentafluorophenyl)phenyl]-8-azatetracyclo[7.5.1.02,7.013,15]pentadeca-2,4,6,9,11,13(15)-hexaene |
| SMILES | Cc1cccc2c1C1(C)c3c(cccc3N2c2c(F)c(F)c(-c3c(F)c(F)c(F)c(F)c3F)c(F)c2F)C1C |
| InChI | InChI=1S/C29H16F9N/c1-10-6-4-8-13-17(10)29(3)11(2)12-7-5-9-14(18(12)29)39(13)28-26(37)21(32)16(22(33)27(28)38)15-19(30)23(34)25(36)24(35)20(15)31/h4-9,11H,1-3H3 |
| InChIKey | FAFNHXSLRLIDPP-UHFFFAOYSA-N |
| XLogP | 9.12 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.44 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|