C21H18N6S2 — CID 163540110
[3-(2-ethenyl-1,3-thiazol-4-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-(4-thiophen-2-ylphenyl)methanimine (PubChem CID 163540110) has the molecular formula C21H18N6S2 and a molecular weight of 418.55 g/mol. Its IUPAC name is [3-(2-ethenyl-1,3-thiazol-4-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-(4-thiophen-2-ylphenyl)methanimine.
| Compound Name | [3-(2-ethenyl-1,3-thiazol-4-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-(4-thiophen-2-ylphenyl)methanimine |
|---|---|
| PubChem CID | 163540110 |
| Molecular Formula | C21H18N6S2 |
| Molecular Weight | 418.55 g/mol |
| Exact Mass | 418.10 |
| IUPAC Name | [3-(2-ethenyl-1,3-thiazol-4-yl)-6,8-dihydro-5H-[1,2,4]triazolo[4,3-a]pyrazin-7-yl]-(4-thiophen-2-ylphenyl)methanimine |
| SMILES | [H]/N=C(\c1ccc(-c2cccs2)cc1)N1CCn2c(nnc2-c2csc(C=C)n2)C1 |
| InChI | InChI=1S/C21H18N6S2/c1-2-19-23-16(13-29-19)21-25-24-18-12-26(9-10-27(18)21)20(22)15-7-5-14(6-8-15)17-4-3-11-28-17/h2-8,11,13,22H,1,9-10,12H2/b22-20+ |
| InChIKey | FAJYSOXTFAJPAB-LSDHQDQOSA-N |
| XLogP | 4.61 |
| TPSA | 70.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.55 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|