C20H21N9O — CID 163540957
N'-diazenyl-4-[[4-(6,8-dimethyl-1-oxo-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-7-yl)pyrimidin-2-yl]amino]benzenecarboximidamide (PubChem CID 163540957) has the molecular formula C20H21N9O and a molecular weight of 403.45 g/mol. Its IUPAC name is N'-diazenyl-4-[[4-(6,8-dimethyl-1-oxo-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-7-yl)pyrimidin-2-yl]amino]benzenecarboximidamide.
| Compound Name | N'-diazenyl-4-[[4-(6,8-dimethyl-1-oxo-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-7-yl)pyrimidin-2-yl]amino]benzenecarboximidamide |
|---|---|
| PubChem CID | 163540957 |
| Molecular Formula | C20H21N9O |
| Molecular Weight | 403.45 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | N'-diazenyl-4-[[4-(6,8-dimethyl-1-oxo-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-7-yl)pyrimidin-2-yl]amino]benzenecarboximidamide |
| SMILES | [H]/N=N/N=C(N)c1ccc(Nc2nccc(-c3c(C)c4n(c3C)CCNC4=O)n2)cc1 |
| InChI | InChI=1S/C20H21N9O/c1-11-16(12(2)29-10-9-23-19(30)17(11)29)15-7-8-24-20(26-15)25-14-5-3-13(4-6-14)18(21)27-28-22/h3-8H,9-10H2,1-2H3,(H,23,30)(H3,21,22,27)(H,24,25,26) |
| InChIKey | FBAYNKHHDPFVKS-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 146.43 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.45 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|