C11H12ClF2N3 — CID 163541117
5-[4-(chloromethyl)cyclohexa-1,3-dien-1-yl]-3-(difluoromethyl)-1-methyl-1,2,4-triazole (PubChem CID 163541117) has the molecular formula C11H12ClF2N3 and a molecular weight of 259.69 g/mol. Its IUPAC name is 5-[4-(chloromethyl)cyclohexa-1,3-dien-1-yl]-3-(difluoromethyl)-1-methyl-1,2,4-triazole.
| Compound Name | 5-[4-(chloromethyl)cyclohexa-1,3-dien-1-yl]-3-(difluoromethyl)-1-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 163541117 |
| Molecular Formula | C11H12ClF2N3 |
| Molecular Weight | 259.69 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 5-[4-(chloromethyl)cyclohexa-1,3-dien-1-yl]-3-(difluoromethyl)-1-methyl-1,2,4-triazole |
| SMILES | Cn1nc(C(F)F)nc1C1=CC=C(CCl)CC1 |
| InChI | InChI=1S/C11H12ClF2N3/c1-17-11(15-10(16-17)9(13)14)8-4-2-7(6-12)3-5-8/h2,4,9H,3,5-6H2,1H3 |
| InChIKey | FBDZKCDOGCBVIV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.69 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|