C19H24F2N2O3S — CID 163541546
N-cyclohexyl-4-fluoro-3-[[[(3E,5E)-6-fluorohexa-1,3,5-trien-3-yl]amino]-hydroxymethyl]benzenesulfonamide (PubChem CID 163541546) has the molecular formula C19H24F2N2O3S and a molecular weight of 398.48 g/mol. Its IUPAC name is N-cyclohexyl-4-fluoro-3-[[[(3E,5E)-6-fluorohexa-1,3,5-trien-3-yl]amino]-hydroxymethyl]benzenesulfonamide.
| Compound Name | N-cyclohexyl-4-fluoro-3-[[[(3E,5E)-6-fluorohexa-1,3,5-trien-3-yl]amino]-hydroxymethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 163541546 |
| Molecular Formula | C19H24F2N2O3S |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | N-cyclohexyl-4-fluoro-3-[[[(3E,5E)-6-fluorohexa-1,3,5-trien-3-yl]amino]-hydroxymethyl]benzenesulfonamide |
| SMILES | C=C/C(=C\C=C\F)NC(O)c1cc(S(=O)(=O)NC2CCCCC2)ccc1F |
| InChI | InChI=1S/C19H24F2N2O3S/c1-2-14(9-6-12-20)22-19(24)17-13-16(10-11-18(17)21)27(25,26)23-15-7-4-3-5-8-15/h2,6,9-13,15,19,22-24H,1,3-5,7-8H2/b12-6+,14-9+ |
| InChIKey | FBMRKCKUMFCDSO-WZGXVBCRSA-N |
| XLogP | 3.57 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|