About 7-(2-cyclohexylethyl)-1-methyltricyclo[4.2.0.02,5]octane
7-(2-cyclohexylethyl)-1-methyltricyclo[4.2.0.02,5]octane (PubChem CID 163542026) has the molecular formula C17H28
and a molecular weight of 232.41 g/mol. Its IUPAC name is 7-(2-cyclohexylethyl)-1-methyltricyclo[4.2.0.02,5]octane.
Analyze 7-(2-cyclohexylethyl)-1-methyltricyclo[4.2.0.02,5]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2-cyclohexylethyl)-1-methyltricyclo[4.2.0.02,5]octane?
The IUPAC name of 7-(2-cyclohexylethyl)-1-methyltricyclo[4.2.0.02,5]octane (CID 163542026) is 7-(2-cyclohexylethyl)-1-methyltricyclo[4.2.0.02,5]octane.
What is the SMILES notation for 7-(2-cyclohexylethyl)-1-methyltricyclo[4.2.0.02,5]octane?
The canonical SMILES for 7-(2-cyclohexylethyl)-1-methyltricyclo[4.2.0.02,5]octane is CC12CC(CCC3CCCCC3)C1C1CCC12.
What is the InChIKey of 7-(2-cyclohexylethyl)-1-methyltricyclo[4.2.0.02,5]octane?
The InChIKey is FBXPEXYCTLMYSL-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28/c1-17-11-13(16(17)14-9-10-15(14)17)8-7-12-5-3-2-4-6-12/h12-16H,2-11H2,1H3.
What are the key properties of 7-(2-cyclohexylethyl)-1-methyltricyclo[4.2.0.02,5]octane?
7-(2-cyclohexylethyl)-1-methyltricyclo[4.2.0.02,5]octane has a molecular weight of 232.41 g/mol, XLogP of 5.03, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2-cyclohexylethyl)-1-methyltricyclo[4.2.0.02,5]octane is sourced from PubChem (CID 163542026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).