C51H69N5 — CID 163542542
8-[5-(4-cyclohexa-2,4-dien-1-yl-6-cyclohexyl-1,3,5-triazinan-2-yl)cyclohex-3-en-1-yl]-7-(cyclohexen-1-yl)-5-cyclohexyl-4a,5a,8,9,10,11,12a,12b-octahydroindolo[2,3-b]carbazole (PubChem CID 163542542) has the molecular formula C51H69N5 and a molecular weight of 752.15 g/mol. Its IUPAC name is 8-[5-(4-cyclohexa-2,4-dien-1-yl-6-cyclohexyl-1,3,5-triazinan-2-yl)cyclohex-3-en-1-yl]-7-(cyclohexen-1-yl)-5-cyclohexyl-4a,5a,8,9,10,11,12a,12b-octahydroindolo[2,3-b]carbazole.
| Compound Name | 8-[5-(4-cyclohexa-2,4-dien-1-yl-6-cyclohexyl-1,3,5-triazinan-2-yl)cyclohex-3-en-1-yl]-7-(cyclohexen-1-yl)-5-cyclohexyl-4a,5a,8,9,10,11,12a,12b-octahydroindolo[2,3-b]carbazole |
|---|---|
| PubChem CID | 163542542 |
| Molecular Formula | C51H69N5 |
| Molecular Weight | 752.15 g/mol |
| Exact Mass | 751.56 |
| IUPAC Name | 8-[5-(4-cyclohexa-2,4-dien-1-yl-6-cyclohexyl-1,3,5-triazinan-2-yl)cyclohex-3-en-1-yl]-7-(cyclohexen-1-yl)-5-cyclohexyl-4a,5a,8,9,10,11,12a,12b-octahydroindolo[2,3-b]carbazole |
| SMILES | C1=CCC(C2NC(C3C=CCC(C4CCCc5c4n(C4=CCCCC4)c4c5=CC5C6C=CC=CC6N(C6CCCCC6)C5C=4)C3)NC(C3CCCCC3)N2)C=C1 |
| InChI | InChI=1S/C51H69N5/c1-5-17-34(18-6-1)49-52-50(35-19-7-2-8-20-35)54-51(53-49)37-22-15-21-36(31-37)40-28-16-29-42-44-32-43-41-27-13-14-30-45(41)55(38-23-9-3-10-24-38)46(43)33-47(44)56(48(40)42)39-25-11-4-12-26-39/h1,5-6,13-15,17,22,25,27,30,32-38,40-41,43,45-46,49-54H,2-4,7-12,16,18-21,23-24,26,28-29,31H2 |
| InChIKey | FCHZTJGKUDYVDN-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 44.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 752.15 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|