C15H14N2O4 — CID 163542742
7,13-dimethyl-7,13-diazapentacyclo[8.5.0.01,4.05,9.011,15]pentadec-2-ene-6,8,12,14-tetrone (PubChem CID 163542742) has the molecular formula C15H14N2O4 and a molecular weight of 286.29 g/mol. Its IUPAC name is 7,13-dimethyl-7,13-diazapentacyclo[8.5.0.01,4.05,9.011,15]pentadec-2-ene-6,8,12,14-tetrone.
| Compound Name | 7,13-dimethyl-7,13-diazapentacyclo[8.5.0.01,4.05,9.011,15]pentadec-2-ene-6,8,12,14-tetrone |
|---|---|
| PubChem CID | 163542742 |
| Molecular Formula | C15H14N2O4 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 7,13-dimethyl-7,13-diazapentacyclo[8.5.0.01,4.05,9.011,15]pentadec-2-ene-6,8,12,14-tetrone |
| SMILES | CN1C(=O)C2C(C1=O)C1C3C(=O)N(C)C(=O)C3C13C=CC23 |
| InChI | InChI=1S/C15H14N2O4/c1-16-11(18)6-5-3-4-15(5)9(7(6)12(16)19)8-10(15)14(21)17(2)13(8)20/h3-10H,1-2H3 |
| InChIKey | FCMRGWNARFWXJC-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|