About (2-ethylcyclopenta-2,4-dien-1-yl)methylidene-methylazanium
(2-ethylcyclopenta-2,4-dien-1-yl)methylidene-methylazanium (PubChem CID 163543370) has the molecular formula C9H14N+
and a molecular weight of 136.22 g/mol. Its IUPAC name is (2-ethylcyclopenta-2,4-dien-1-yl)methylidene-methylazanium.
Molecular Properties
| Compound Name | (2-ethylcyclopenta-2,4-dien-1-yl)methylidene-methylazanium |
| PubChem CID | 163543370 |
| Molecular Formula | C9H14N+ |
| Molecular Weight | 136.22 g/mol |
| Exact Mass | 136.11 |
| IUPAC Name | (2-ethylcyclopenta-2,4-dien-1-yl)methylidene-methylazanium |
| SMILES | CCC1=CC=CC1/C=[NH+]/C |
| InChI | InChI=1S/C9H13N/c1-3-8-5-4-6-9(8)7-10-2/h4-7,9H,3H2,1-2H3/p+1/b10-7+ |
| InChIKey | FCZKMECARQQUMP-JXMROGBWSA-O |
| XLogP | 0.29 |
| TPSA | 13.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.22 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (2-ethylcyclopenta-2,4-dien-1-yl)methylidene-methylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethylcyclopenta-2,4-dien-1-yl)methylidene-methylazanium?
The IUPAC name of (2-ethylcyclopenta-2,4-dien-1-yl)methylidene-methylazanium (CID 163543370) is (2-ethylcyclopenta-2,4-dien-1-yl)methylidene-methylazanium.
What is the SMILES notation for (2-ethylcyclopenta-2,4-dien-1-yl)methylidene-methylazanium?
The canonical SMILES for (2-ethylcyclopenta-2,4-dien-1-yl)methylidene-methylazanium is CCC1=CC=CC1/C=[NH+]/C.
What is the InChIKey of (2-ethylcyclopenta-2,4-dien-1-yl)methylidene-methylazanium?
The InChIKey is FCZKMECARQQUMP-JXMROGBWSA-O. The full InChI is InChI=1S/C9H13N/c1-3-8-5-4-6-9(8)7-10-2/h4-7,9H,3H2,1-2H3/p+1/b10-7+.
What are the key properties of (2-ethylcyclopenta-2,4-dien-1-yl)methylidene-methylazanium?
(2-ethylcyclopenta-2,4-dien-1-yl)methylidene-methylazanium has a molecular weight of 136.22 g/mol, XLogP of 0.29, 2 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethylcyclopenta-2,4-dien-1-yl)methylidene-methylazanium is sourced from PubChem (CID 163543370), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).