C25H36O2 — CID 163543668
(16S)-9-ethyl-4-methyl-13-pentyl-7,11,12,15,16,17-hexahydro-6H-cyclopenta[a]phenanthrene-3,16-diol (PubChem CID 163543668) has the molecular formula C25H36O2 and a molecular weight of 368.56 g/mol. Its IUPAC name is (16S)-9-ethyl-4-methyl-13-pentyl-7,11,12,15,16,17-hexahydro-6H-cyclopenta[a]phenanthrene-3,16-diol.
| Compound Name | (16S)-9-ethyl-4-methyl-13-pentyl-7,11,12,15,16,17-hexahydro-6H-cyclopenta[a]phenanthrene-3,16-diol |
|---|---|
| PubChem CID | 163543668 |
| Molecular Formula | C25H36O2 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.27 |
| IUPAC Name | (16S)-9-ethyl-4-methyl-13-pentyl-7,11,12,15,16,17-hexahydro-6H-cyclopenta[a]phenanthrene-3,16-diol |
| SMILES | CCCCCC12CCC3(CC)C(=C1C[C@@H](O)C2)CCc1c3ccc(O)c1C |
| InChI | InChI=1S/C25H36O2/c1-4-6-7-12-24-13-14-25(5-2)20-10-11-23(27)17(3)19(20)8-9-21(25)22(24)15-18(26)16-24/h10-11,18,26-27H,4-9,12-16H2,1-3H3/t18-,24?,25?/m1/s1 |
| InChIKey | FDESDRDTFZICKB-SGAUDOEVSA-N |
| XLogP | 6.11 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|