About 2-[[6-(3,4-diiodophenyl)pyrimidin-4-yl]amino]-1-naphthalen-2-ylethanol
2-[[6-(3,4-diiodophenyl)pyrimidin-4-yl]amino]-1-naphthalen-2-ylethanol (PubChem CID 163543738) has the molecular formula C22H17I2N3O
and a molecular weight of 593.21 g/mol. Its IUPAC name is 2-[[6-(3,4-diiodophenyl)pyrimidin-4-yl]amino]-1-naphthalen-2-ylethanol.
Molecular Properties
| Compound Name | 2-[[6-(3,4-diiodophenyl)pyrimidin-4-yl]amino]-1-naphthalen-2-ylethanol |
| PubChem CID | 163543738 |
| Molecular Formula | C22H17I2N3O |
| Molecular Weight | 593.21 g/mol |
| Exact Mass | 592.95 |
| IUPAC Name | 2-[[6-(3,4-diiodophenyl)pyrimidin-4-yl]amino]-1-naphthalen-2-ylethanol |
| SMILES | OC(CNc1cc(-c2ccc(I)c(I)c2)ncn1)c1ccc2ccccc2c1 |
| InChI | InChI=1S/C22H17I2N3O/c23-18-8-7-16(10-19(18)24)20-11-22(27-13-26-20)25-12-21(28)17-6-5-14-3-1-2-4-15(14)9-17/h1-11,13,21,28H,12H2,(H,25,26,27) |
| InChIKey | FDGDOOBNSCBHLC-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 58.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 593.21 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-[[6-(3,4-diiodophenyl)pyrimidin-4-yl]amino]-1-naphthalen-2-ylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[[6-(3,4-diiodophenyl)pyrimidin-4-yl]amino]-1-naphthalen-2-ylethanol?
The IUPAC name of 2-[[6-(3,4-diiodophenyl)pyrimidin-4-yl]amino]-1-naphthalen-2-ylethanol (CID 163543738) is 2-[[6-(3,4-diiodophenyl)pyrimidin-4-yl]amino]-1-naphthalen-2-ylethanol.
What is the SMILES notation for 2-[[6-(3,4-diiodophenyl)pyrimidin-4-yl]amino]-1-naphthalen-2-ylethanol?
The canonical SMILES for 2-[[6-(3,4-diiodophenyl)pyrimidin-4-yl]amino]-1-naphthalen-2-ylethanol is OC(CNc1cc(-c2ccc(I)c(I)c2)ncn1)c1ccc2ccccc2c1.
What is the InChIKey of 2-[[6-(3,4-diiodophenyl)pyrimidin-4-yl]amino]-1-naphthalen-2-ylethanol?
The InChIKey is FDGDOOBNSCBHLC-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17I2N3O/c23-18-8-7-16(10-19(18)24)20-11-22(27-13-26-20)25-12-21(28)17-6-5-14-3-1-2-4-15(14)9-17/h1-11,13,21,28H,12H2,(H,25,26,27).
What are the key properties of 2-[[6-(3,4-diiodophenyl)pyrimidin-4-yl]amino]-1-naphthalen-2-ylethanol?
2-[[6-(3,4-diiodophenyl)pyrimidin-4-yl]amino]-1-naphthalen-2-ylethanol has a molecular weight of 593.21 g/mol, XLogP of 5.65, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[[6-(3,4-diiodophenyl)pyrimidin-4-yl]amino]-1-naphthalen-2-ylethanol is sourced from PubChem (CID 163543738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).