About 2-(2-chloroethyl)-5,6-dimethoxycyclohexa-1,3-diene
2-(2-chloroethyl)-5,6-dimethoxycyclohexa-1,3-diene (PubChem CID 163543757) has the molecular formula C10H15ClO2
and a molecular weight of 202.68 g/mol. Its IUPAC name is 2-(2-chloroethyl)-5,6-dimethoxycyclohexa-1,3-diene.
Molecular Properties
| Compound Name | 2-(2-chloroethyl)-5,6-dimethoxycyclohexa-1,3-diene |
| PubChem CID | 163543757 |
| Molecular Formula | C10H15ClO2 |
| Molecular Weight | 202.68 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | 2-(2-chloroethyl)-5,6-dimethoxycyclohexa-1,3-diene |
| SMILES | COC1C=CC(CCCl)=CC1OC |
| InChI | InChI=1S/C10H15ClO2/c1-12-9-4-3-8(5-6-11)7-10(9)13-2/h3-4,7,9-10H,5-6H2,1-2H3 |
| InChIKey | FDGPOBOCIHSMTC-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.68 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-chloroethyl)-5,6-dimethoxycyclohexa-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-chloroethyl)-5,6-dimethoxycyclohexa-1,3-diene?
The IUPAC name of 2-(2-chloroethyl)-5,6-dimethoxycyclohexa-1,3-diene (CID 163543757) is 2-(2-chloroethyl)-5,6-dimethoxycyclohexa-1,3-diene.
What is the SMILES notation for 2-(2-chloroethyl)-5,6-dimethoxycyclohexa-1,3-diene?
The canonical SMILES for 2-(2-chloroethyl)-5,6-dimethoxycyclohexa-1,3-diene is COC1C=CC(CCCl)=CC1OC.
What is the InChIKey of 2-(2-chloroethyl)-5,6-dimethoxycyclohexa-1,3-diene?
The InChIKey is FDGPOBOCIHSMTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15ClO2/c1-12-9-4-3-8(5-6-11)7-10(9)13-2/h3-4,7,9-10H,5-6H2,1-2H3.
What are the key properties of 2-(2-chloroethyl)-5,6-dimethoxycyclohexa-1,3-diene?
2-(2-chloroethyl)-5,6-dimethoxycyclohexa-1,3-diene has a molecular weight of 202.68 g/mol, XLogP of 2.14, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-chloroethyl)-5,6-dimethoxycyclohexa-1,3-diene is sourced from PubChem (CID 163543757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).