About 5-diazenyl-7-methyl-1,3-dioxa-2-azanidacyclooctane-4,8-dione
5-diazenyl-7-methyl-1,3-dioxa-2-azanidacyclooctane-4,8-dione (PubChem CID 163546354) has the molecular formula C6H8N3O4-
and a molecular weight of 186.15 g/mol. Its IUPAC name is 5-diazenyl-7-methyl-1,3-dioxa-2-azanidacyclooctane-4,8-dione.
Molecular Properties
| Compound Name | 5-diazenyl-7-methyl-1,3-dioxa-2-azanidacyclooctane-4,8-dione |
| PubChem CID | 163546354 |
| Molecular Formula | C6H8N3O4- |
| Molecular Weight | 186.15 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 5-diazenyl-7-methyl-1,3-dioxa-2-azanidacyclooctane-4,8-dione |
| SMILES | [H]/N=N/C1CC(C)C(=O)O[N-]OC1=O |
| InChI | InChI=1S/C6H8N3O4/c1-3-2-4(8-7)6(11)13-9-12-5(3)10/h3-4,7H,2H2,1H3/q-1/b8-7+ |
| InChIKey | FFJDEIDUCLRLIR-BQYQJAHWSA-N |
| XLogP | 0.72 |
| TPSA | 102.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.15 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 5-diazenyl-7-methyl-1,3-dioxa-2-azanidacyclooctane-4,8-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-diazenyl-7-methyl-1,3-dioxa-2-azanidacyclooctane-4,8-dione?
The IUPAC name of 5-diazenyl-7-methyl-1,3-dioxa-2-azanidacyclooctane-4,8-dione (CID 163546354) is 5-diazenyl-7-methyl-1,3-dioxa-2-azanidacyclooctane-4,8-dione.
What is the SMILES notation for 5-diazenyl-7-methyl-1,3-dioxa-2-azanidacyclooctane-4,8-dione?
The canonical SMILES for 5-diazenyl-7-methyl-1,3-dioxa-2-azanidacyclooctane-4,8-dione is [H]/N=N/C1CC(C)C(=O)O[N-]OC1=O.
What is the InChIKey of 5-diazenyl-7-methyl-1,3-dioxa-2-azanidacyclooctane-4,8-dione?
The InChIKey is FFJDEIDUCLRLIR-BQYQJAHWSA-N. The full InChI is InChI=1S/C6H8N3O4/c1-3-2-4(8-7)6(11)13-9-12-5(3)10/h3-4,7H,2H2,1H3/q-1/b8-7+.
What are the key properties of 5-diazenyl-7-methyl-1,3-dioxa-2-azanidacyclooctane-4,8-dione?
5-diazenyl-7-methyl-1,3-dioxa-2-azanidacyclooctane-4,8-dione has a molecular weight of 186.15 g/mol, XLogP of 0.72, 1 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-diazenyl-7-methyl-1,3-dioxa-2-azanidacyclooctane-4,8-dione is sourced from PubChem (CID 163546354), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).