C11H11N5O4 — CID 163546638
(2R)-5-(hydroxymethyl)-2-[6-(methylideneamino)purin-9-yl]-2,3-dihydrofuran-3,4-diol (PubChem CID 163546638) has the molecular formula C11H11N5O4 and a molecular weight of 277.24 g/mol. Its IUPAC name is (2R)-5-(hydroxymethyl)-2-[6-(methylideneamino)purin-9-yl]-2,3-dihydrofuran-3,4-diol.
| Compound Name | (2R)-5-(hydroxymethyl)-2-[6-(methylideneamino)purin-9-yl]-2,3-dihydrofuran-3,4-diol |
|---|---|
| PubChem CID | 163546638 |
| Molecular Formula | C11H11N5O4 |
| Molecular Weight | 277.24 g/mol |
| Exact Mass | 277.08 |
| IUPAC Name | (2R)-5-(hydroxymethyl)-2-[6-(methylideneamino)purin-9-yl]-2,3-dihydrofuran-3,4-diol |
| SMILES | C=Nc1ncnc2c1ncn2[C@@H]1OC(CO)=C(O)C1O |
| InChI | InChI=1S/C11H11N5O4/c1-12-9-6-10(14-3-13-9)16(4-15-6)11-8(19)7(18)5(2-17)20-11/h3-4,8,11,17-19H,1-2H2/t8?,11-/m1/s1 |
| InChIKey | FFOODUGVKONXLB-QHDYGNBISA-N |
| XLogP | -0.19 |
| TPSA | 125.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.24 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|