About 2-(aminomethyl)-1,3-thiazole-4-thiol
2-(aminomethyl)-1,3-thiazole-4-thiol (PubChem CID 163546642) has the molecular formula C4H6N2S2
and a molecular weight of 146.24 g/mol. Its IUPAC name is 2-(aminomethyl)-1,3-thiazole-4-thiol.
Molecular Properties
| Compound Name | 2-(aminomethyl)-1,3-thiazole-4-thiol |
| PubChem CID | 163546642 |
| Molecular Formula | C4H6N2S2 |
| Molecular Weight | 146.24 g/mol |
| Exact Mass | 146.00 |
| IUPAC Name | 2-(aminomethyl)-1,3-thiazole-4-thiol |
| SMILES | NCc1nc(S)cs1 |
| InChI | InChI=1S/C4H6N2S2/c5-1-4-6-3(7)2-8-4/h2,7H,1,5H2 |
| InChIKey | FFOSEOAJAUDHJP-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.24 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(aminomethyl)-1,3-thiazole-4-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(aminomethyl)-1,3-thiazole-4-thiol?
The IUPAC name of 2-(aminomethyl)-1,3-thiazole-4-thiol (CID 163546642) is 2-(aminomethyl)-1,3-thiazole-4-thiol.
What is the SMILES notation for 2-(aminomethyl)-1,3-thiazole-4-thiol?
The canonical SMILES for 2-(aminomethyl)-1,3-thiazole-4-thiol is NCc1nc(S)cs1.
What is the InChIKey of 2-(aminomethyl)-1,3-thiazole-4-thiol?
The InChIKey is FFOSEOAJAUDHJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6N2S2/c5-1-4-6-3(7)2-8-4/h2,7H,1,5H2.
What are the key properties of 2-(aminomethyl)-1,3-thiazole-4-thiol?
2-(aminomethyl)-1,3-thiazole-4-thiol has a molecular weight of 146.24 g/mol, XLogP of 0.89, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminomethyl)-1,3-thiazole-4-thiol is sourced from PubChem (CID 163546642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).