C26H40N2O8S — CID 163546920
2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-[(1R,2R)-2-hydroxy-1-[[(2S,4R)-4-propylpyrrolidine-2-carbonyl]amino]propyl]oxan-2-yl]sulfanylethyl 4-methylbenzoate (PubChem CID 163546920) has the molecular formula C26H40N2O8S and a molecular weight of 540.68 g/mol. Its IUPAC name is 2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-[(1R,2R)-2-hydroxy-1-[[(2S,4R)-4-propylpyrrolidine-2-carbonyl]amino]propyl]oxan-2-yl]sulfanylethyl 4-methylbenzoate.
| Compound Name | 2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-[(1R,2R)-2-hydroxy-1-[[(2S,4R)-4-propylpyrrolidine-2-carbonyl]amino]propyl]oxan-2-yl]sulfanylethyl 4-methylbenzoate |
|---|---|
| PubChem CID | 163546920 |
| Molecular Formula | C26H40N2O8S |
| Molecular Weight | 540.68 g/mol |
| Exact Mass | 540.25 |
| IUPAC Name | 2-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-[(1R,2R)-2-hydroxy-1-[[(2S,4R)-4-propylpyrrolidine-2-carbonyl]amino]propyl]oxan-2-yl]sulfanylethyl 4-methylbenzoate |
| SMILES | CCC[C@H]1CN[C@H](C(=O)N[C@@H]([C@H]2O[C@H](SCCOC(=O)c3ccc(C)cc3)[C@H](O)[C@@H](O)[C@H]2O)[C@@H](C)O)C1 |
| InChI | InChI=1S/C26H40N2O8S/c1-4-5-16-12-18(27-13-16)24(33)28-19(15(3)29)23-21(31)20(30)22(32)26(36-23)37-11-10-35-25(34)17-8-6-14(2)7-9-17/h6-9,15-16,18-23,26-27,29-32H,4-5,10-13H2,1-3H3,(H,28,33)/t15-,16-,18+,19-,20+,21-,22-,23-,26-/m1/s1 |
| InChIKey | FFVADQWTQMGVCA-YXRXNQOCSA-N |
| XLogP | 0.34 |
| TPSA | 157.58 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.68 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|