C25H46N4O3 — CID 163547591
3-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-1-(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl)-1-pent-4-ynylurea (PubChem CID 163547591) has the molecular formula C25H46N4O3 and a molecular weight of 450.67 g/mol. Its IUPAC name is 3-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-1-(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl)-1-pent-4-ynylurea.
| Compound Name | 3-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-1-(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl)-1-pent-4-ynylurea |
|---|---|
| PubChem CID | 163547591 |
| Molecular Formula | C25H46N4O3 |
| Molecular Weight | 450.67 g/mol |
| Exact Mass | 450.36 |
| IUPAC Name | 3-(1-hydroxy-2,2,6,6-tetramethylpiperidin-4-yl)-1-(1-methoxy-2,2,6,6-tetramethylpiperidin-4-yl)-1-pent-4-ynylurea |
| SMILES | C#CCCCN(C(=O)NC1CC(C)(C)N(O)C(C)(C)C1)C1CC(C)(C)N(OC)C(C)(C)C1 |
| InChI | InChI=1S/C25H46N4O3/c1-11-12-13-14-27(20-17-24(6,7)29(32-10)25(8,9)18-20)21(30)26-19-15-22(2,3)28(31)23(4,5)16-19/h1,19-20,31H,12-18H2,2-10H3,(H,26,30) |
| InChIKey | FGJOBUNIOCLXPM-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 68.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.67 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|