About N-ethyl-6-fluorobicyclo[4.1.0]hepta-2,4-diene-3-carboxamide
N-ethyl-6-fluorobicyclo[4.1.0]hepta-2,4-diene-3-carboxamide (PubChem CID 163547775) has the molecular formula C10H12FNO
and a molecular weight of 181.21 g/mol. Its IUPAC name is N-ethyl-6-fluorobicyclo[4.1.0]hepta-2,4-diene-3-carboxamide.
Molecular Properties
| Compound Name | N-ethyl-6-fluorobicyclo[4.1.0]hepta-2,4-diene-3-carboxamide |
| PubChem CID | 163547775 |
| Molecular Formula | C10H12FNO |
| Molecular Weight | 181.21 g/mol |
| Exact Mass | 181.09 |
| IUPAC Name | N-ethyl-6-fluorobicyclo[4.1.0]hepta-2,4-diene-3-carboxamide |
| SMILES | CCNC(=O)C1=CC2CC2(F)C=C1 |
| InChI | InChI=1S/C10H12FNO/c1-2-12-9(13)7-3-4-10(11)6-8(10)5-7/h3-5,8H,2,6H2,1H3,(H,12,13) |
| InChIKey | FGMOZFGUMAUSAA-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.21 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-ethyl-6-fluorobicyclo[4.1.0]hepta-2,4-diene-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-6-fluorobicyclo[4.1.0]hepta-2,4-diene-3-carboxamide?
The IUPAC name of N-ethyl-6-fluorobicyclo[4.1.0]hepta-2,4-diene-3-carboxamide (CID 163547775) is N-ethyl-6-fluorobicyclo[4.1.0]hepta-2,4-diene-3-carboxamide.
What is the SMILES notation for N-ethyl-6-fluorobicyclo[4.1.0]hepta-2,4-diene-3-carboxamide?
The canonical SMILES for N-ethyl-6-fluorobicyclo[4.1.0]hepta-2,4-diene-3-carboxamide is CCNC(=O)C1=CC2CC2(F)C=C1.
What is the InChIKey of N-ethyl-6-fluorobicyclo[4.1.0]hepta-2,4-diene-3-carboxamide?
The InChIKey is FGMOZFGUMAUSAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12FNO/c1-2-12-9(13)7-3-4-10(11)6-8(10)5-7/h3-5,8H,2,6H2,1H3,(H,12,13).
What are the key properties of N-ethyl-6-fluorobicyclo[4.1.0]hepta-2,4-diene-3-carboxamide?
N-ethyl-6-fluorobicyclo[4.1.0]hepta-2,4-diene-3-carboxamide has a molecular weight of 181.21 g/mol, XLogP of 1.35, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-6-fluorobicyclo[4.1.0]hepta-2,4-diene-3-carboxamide is sourced from PubChem (CID 163547775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).