C25H40N4O — CID 163548036
N-[1-[[4-(3-piperidin-1-ylpropoxy)cyclohexa-2,4-dien-1-yl]methyl]piperidin-4-yl]-1,2-dihydropyridin-6-amine (PubChem CID 163548036) has the molecular formula C25H40N4O and a molecular weight of 412.62 g/mol. Its IUPAC name is N-[1-[[4-(3-piperidin-1-ylpropoxy)cyclohexa-2,4-dien-1-yl]methyl]piperidin-4-yl]-1,2-dihydropyridin-6-amine.
| Compound Name | N-[1-[[4-(3-piperidin-1-ylpropoxy)cyclohexa-2,4-dien-1-yl]methyl]piperidin-4-yl]-1,2-dihydropyridin-6-amine |
|---|---|
| PubChem CID | 163548036 |
| Molecular Formula | C25H40N4O |
| Molecular Weight | 412.62 g/mol |
| Exact Mass | 412.32 |
| IUPAC Name | N-[1-[[4-(3-piperidin-1-ylpropoxy)cyclohexa-2,4-dien-1-yl]methyl]piperidin-4-yl]-1,2-dihydropyridin-6-amine |
| SMILES | C1=CCNC(NC2CCN(CC3C=CC(OCCCN4CCCCC4)=CC3)CC2)=C1 |
| InChI | InChI=1S/C25H40N4O/c1-4-15-28(16-5-1)17-6-20-30-24-10-8-22(9-11-24)21-29-18-12-23(13-19-29)27-25-7-2-3-14-26-25/h2-3,7-8,10-11,22-23,26-27H,1,4-6,9,12-21H2 |
| InChIKey | FGSMHHCYWJQHRF-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 39.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.62 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|