C21H14I2P2 — CID 163548439
(10,10-diiodo-14-phosphanyl-21-pentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(21),2,4,6,8,11,13,15,17,19-decaenyl)phosphane (PubChem CID 163548439) has the molecular formula C21H14I2P2 and a molecular weight of 582.10 g/mol. Its IUPAC name is (10,10-diiodo-14-phosphanyl-21-pentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(21),2,4,6,8,11,13,15,17,19-decaenyl)phosphane.
| Compound Name | (10,10-diiodo-14-phosphanyl-21-pentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(21),2,4,6,8,11,13,15,17,19-decaenyl)phosphane |
|---|---|
| PubChem CID | 163548439 |
| Molecular Formula | C21H14I2P2 |
| Molecular Weight | 582.10 g/mol |
| Exact Mass | 581.87 |
| IUPAC Name | (10,10-diiodo-14-phosphanyl-21-pentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(21),2,4,6,8,11,13,15,17,19-decaenyl)phosphane |
| SMILES | Pc1c2ccccc2c(P)c2cc3c(cc12)-c1ccccc1C3(I)I |
| InChI | InChI=1S/C21H14I2P2/c22-21(23)17-8-4-3-5-11(17)14-9-15-16(10-18(14)21)20(25)13-7-2-1-6-12(13)19(15)24/h1-10H,24-25H2 |
| InChIKey | FHADBQBQGQTNTH-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.10 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|