C26H32F2N4O3 — CID 163548715
7-fluoro-8-[1-[(3S,4R)-3-fluoro-4-(2,3,6,7-tetrahydro-1,4-benzodioxin-6-ylmethylamino)piperidin-1-yl]propan-2-yl]-1-methyl-1,5-naphthyridin-2-one (PubChem CID 163548715) has the molecular formula C26H32F2N4O3 and a molecular weight of 486.56 g/mol. Its IUPAC name is 7-fluoro-8-[1-[(3S,4R)-3-fluoro-4-(2,3,6,7-tetrahydro-1,4-benzodioxin-6-ylmethylamino)piperidin-1-yl]propan-2-yl]-1-methyl-1,5-naphthyridin-2-one.
| Compound Name | 7-fluoro-8-[1-[(3S,4R)-3-fluoro-4-(2,3,6,7-tetrahydro-1,4-benzodioxin-6-ylmethylamino)piperidin-1-yl]propan-2-yl]-1-methyl-1,5-naphthyridin-2-one |
|---|---|
| PubChem CID | 163548715 |
| Molecular Formula | C26H32F2N4O3 |
| Molecular Weight | 486.56 g/mol |
| Exact Mass | 486.24 |
| IUPAC Name | 7-fluoro-8-[1-[(3S,4R)-3-fluoro-4-(2,3,6,7-tetrahydro-1,4-benzodioxin-6-ylmethylamino)piperidin-1-yl]propan-2-yl]-1-methyl-1,5-naphthyridin-2-one |
| SMILES | CC(CN1CC[C@@H](NCC2C=C3OCCOC3=CC2)[C@@H](F)C1)c1c(F)cnc2ccc(=O)n(C)c12 |
| InChI | InChI=1S/C26H32F2N4O3/c1-16(25-18(27)13-30-21-4-6-24(33)31(2)26(21)25)14-32-8-7-20(19(28)15-32)29-12-17-3-5-22-23(11-17)35-10-9-34-22/h4-6,11,13,16-17,19-20,29H,3,7-10,12,14-15H2,1-2H3/t16?,17?,19-,20+/m0/s1 |
| InChIKey | FHFRASXZQQJVEL-ZYKFHVCXSA-N |
| XLogP | 3.01 |
| TPSA | 68.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.56 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |