C10H17ClFN — CID 163548920
(3E,5E)-8-chloro-5-fluoro-N,6-dimethylocta-3,5-dien-3-amine (PubChem CID 163548920) has the molecular formula C10H17ClFN and a molecular weight of 205.70 g/mol. Its IUPAC name is (3E,5E)-8-chloro-5-fluoro-N,6-dimethylocta-3,5-dien-3-amine.
| Compound Name | (3E,5E)-8-chloro-5-fluoro-N,6-dimethylocta-3,5-dien-3-amine |
|---|---|
| PubChem CID | 163548920 |
| Molecular Formula | C10H17ClFN |
| Molecular Weight | 205.70 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | (3E,5E)-8-chloro-5-fluoro-N,6-dimethylocta-3,5-dien-3-amine |
| SMILES | CC/C(=C\C(F)=C(\C)CCCl)NC |
| InChI | InChI=1S/C10H17ClFN/c1-4-9(13-3)7-10(12)8(2)5-6-11/h7,13H,4-6H2,1-3H3/b9-7+,10-8+ |
| InChIKey | FHJSCHPCHKMROR-FIFLTTCUSA-N |
| XLogP | 3.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.70 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|