C28H45BO5S — CID 163549334
ethyl 2-[4-(4,4-dimethylcyclohexen-1-yl)-2-methyl-5-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]thiophen-3-yl]-2-[(2-methylpropan-2-yl)oxy]acetate (PubChem CID 163549334) has the molecular formula C28H45BO5S and a molecular weight of 504.54 g/mol. Its IUPAC name is ethyl 2-[4-(4,4-dimethylcyclohexen-1-yl)-2-methyl-5-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]thiophen-3-yl]-2-[(2-methylpropan-2-yl)oxy]acetate.
| Compound Name | ethyl 2-[4-(4,4-dimethylcyclohexen-1-yl)-2-methyl-5-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]thiophen-3-yl]-2-[(2-methylpropan-2-yl)oxy]acetate |
|---|---|
| PubChem CID | 163549334 |
| Molecular Formula | C28H45BO5S |
| Molecular Weight | 504.54 g/mol |
| Exact Mass | 504.31 |
| IUPAC Name | ethyl 2-[4-(4,4-dimethylcyclohexen-1-yl)-2-methyl-5-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]thiophen-3-yl]-2-[(2-methylpropan-2-yl)oxy]acetate |
| SMILES | CCOC(=O)C(OC(C)(C)C)c1c(C)sc(CB2OC(C)(C)C(C)(C)O2)c1C1=CCC(C)(C)CC1 |
| InChI | InChI=1S/C28H45BO5S/c1-12-31-24(30)23(32-25(3,4)5)21-18(2)35-20(17-29-33-27(8,9)28(10,11)34-29)22(21)19-13-15-26(6,7)16-14-19/h13,23H,12,14-17H2,1-11H3 |
| InChIKey | FHSMFHTUCRNTNK-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.54 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|