C23H26F3N — CID 163549652
4-[(4-cyclohexa-1,3-dien-1-yl-5-cyclopropyl-2,3,6-trifluoro-6-methylcyclohexa-1,3-dien-1-yl)methyl]cyclohexa-1,3-dien-1-amine (PubChem CID 163549652) has the molecular formula C23H26F3N and a molecular weight of 373.46 g/mol. Its IUPAC name is 4-[(4-cyclohexa-1,3-dien-1-yl-5-cyclopropyl-2,3,6-trifluoro-6-methylcyclohexa-1,3-dien-1-yl)methyl]cyclohexa-1,3-dien-1-amine.
| Compound Name | 4-[(4-cyclohexa-1,3-dien-1-yl-5-cyclopropyl-2,3,6-trifluoro-6-methylcyclohexa-1,3-dien-1-yl)methyl]cyclohexa-1,3-dien-1-amine |
|---|---|
| PubChem CID | 163549652 |
| Molecular Formula | C23H26F3N |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.20 |
| IUPAC Name | 4-[(4-cyclohexa-1,3-dien-1-yl-5-cyclopropyl-2,3,6-trifluoro-6-methylcyclohexa-1,3-dien-1-yl)methyl]cyclohexa-1,3-dien-1-amine |
| SMILES | CC1(F)C(CC2=CC=C(N)CC2)=C(F)C(F)=C(C2=CC=CCC2)C1C1CC1 |
| InChI | InChI=1S/C23H26F3N/c1-23(26)18(13-14-7-11-17(27)12-8-14)21(24)22(25)19(20(23)16-9-10-16)15-5-3-2-4-6-15/h2-3,5,7,11,16,20H,4,6,8-10,12-13,27H2,1H3 |
| InChIKey | FHZUQSPHAQWGAA-UHFFFAOYSA-N |
| XLogP | 6.43 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |