C19H17N7 — CID 163549701
4-(3-methylphenyl)-6-[1-(pyridin-3-ylmethyl)triazol-4-yl]pyrimidin-2-amine (PubChem CID 163549701) has the molecular formula C19H17N7 and a molecular weight of 343.39 g/mol. Its IUPAC name is 4-(3-methylphenyl)-6-[1-(pyridin-3-ylmethyl)triazol-4-yl]pyrimidin-2-amine.
| Compound Name | 4-(3-methylphenyl)-6-[1-(pyridin-3-ylmethyl)triazol-4-yl]pyrimidin-2-amine |
|---|---|
| PubChem CID | 163549701 |
| Molecular Formula | C19H17N7 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 4-(3-methylphenyl)-6-[1-(pyridin-3-ylmethyl)triazol-4-yl]pyrimidin-2-amine |
| SMILES | Cc1cccc(-c2cc(-c3cn(Cc4cccnc4)nn3)nc(N)n2)c1 |
| InChI | InChI=1S/C19H17N7/c1-13-4-2-6-15(8-13)16-9-17(23-19(20)22-16)18-12-26(25-24-18)11-14-5-3-7-21-10-14/h2-10,12H,11H2,1H3,(H2,20,22,23) |
| InChIKey | FIAPWHBWKIYACS-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 95.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |