C20H23F2N3O — CID 163549892
3-(difluoromethyl)-1-methyl-N-(3,11,11-trimethyl-1-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl)pyrazole-4-carboxamide (PubChem CID 163549892) has the molecular formula C20H23F2N3O and a molecular weight of 359.42 g/mol. Its IUPAC name is 3-(difluoromethyl)-1-methyl-N-(3,11,11-trimethyl-1-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl)pyrazole-4-carboxamide.
| Compound Name | 3-(difluoromethyl)-1-methyl-N-(3,11,11-trimethyl-1-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 163549892 |
| Molecular Formula | C20H23F2N3O |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 3-(difluoromethyl)-1-methyl-N-(3,11,11-trimethyl-1-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl)pyrazole-4-carboxamide |
| SMILES | Cc1cccc2c1C1(NC(=O)c3cn(C)nc3C(F)F)CCC2C1(C)C |
| InChI | InChI=1S/C20H23F2N3O/c1-11-6-5-7-12-14-8-9-20(15(11)12,19(14,2)3)23-18(26)13-10-25(4)24-16(13)17(21)22/h5-7,10,14,17H,8-9H2,1-4H3,(H,23,26) |
| InChIKey | FIETUOGCXTZTQV-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |