C10H18 — CID 163550244
trans-(1S,2S)-1-methyl-2-prop-1-en-2-ylcyclohexane (PubChem CID 163550244) has the molecular formula C10H18 and a molecular weight of 138.25 g/mol. Its IUPAC name is trans-(1S,2S)-1-methyl-2-prop-1-en-2-ylcyclohexane.
| Compound Name | trans-(1S,2S)-1-methyl-2-prop-1-en-2-ylcyclohexane |
|---|---|
| PubChem CID | 163550244 |
| Molecular Formula | C10H18 |
| Molecular Weight | 138.25 g/mol |
| Exact Mass | 138.14 |
| IUPAC Name | trans-(1S,2S)-1-methyl-2-prop-1-en-2-ylcyclohexane |
| SMILES | C=C(C)[C@H]1CCCC[C@@H]1C |
| InChI | InChI=1S/C10H18/c1-8(2)10-7-5-4-6-9(10)3/h9-10H,1,4-7H2,2-3H3/t9-,10+/m0/s1 |
| InChIKey | FILMMSADAAQBJS-VHSXEESVSA-N |
| XLogP | 3.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.25 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|