About 5-(4-fluoro-4-methylcyclohexyl)-1,2,3-trimethylbenzene
5-(4-fluoro-4-methylcyclohexyl)-1,2,3-trimethylbenzene (PubChem CID 163550407) has the molecular formula C16H23F
and a molecular weight of 234.36 g/mol. Its IUPAC name is 5-(4-fluoro-4-methylcyclohexyl)-1,2,3-trimethylbenzene.
Molecular Properties
| Compound Name | 5-(4-fluoro-4-methylcyclohexyl)-1,2,3-trimethylbenzene |
| PubChem CID | 163550407 |
| Molecular Formula | C16H23F |
| Molecular Weight | 234.36 g/mol |
| Exact Mass | 234.18 |
| IUPAC Name | 5-(4-fluoro-4-methylcyclohexyl)-1,2,3-trimethylbenzene |
| SMILES | Cc1cc(C2CCC(C)(F)CC2)cc(C)c1C |
| InChI | InChI=1S/C16H23F/c1-11-9-15(10-12(2)13(11)3)14-5-7-16(4,17)8-6-14/h9-10,14H,5-8H2,1-4H3 |
| InChIKey | ZOKXTOXXPPBBLZ-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.36 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 5-(4-fluoro-4-methylcyclohexyl)-1,2,3-trimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-fluoro-4-methylcyclohexyl)-1,2,3-trimethylbenzene?
The IUPAC name of 5-(4-fluoro-4-methylcyclohexyl)-1,2,3-trimethylbenzene (CID 163550407) is 5-(4-fluoro-4-methylcyclohexyl)-1,2,3-trimethylbenzene.
What is the SMILES notation for 5-(4-fluoro-4-methylcyclohexyl)-1,2,3-trimethylbenzene?
The canonical SMILES for 5-(4-fluoro-4-methylcyclohexyl)-1,2,3-trimethylbenzene is Cc1cc(C2CCC(C)(F)CC2)cc(C)c1C.
What is the InChIKey of 5-(4-fluoro-4-methylcyclohexyl)-1,2,3-trimethylbenzene?
The InChIKey is ZOKXTOXXPPBBLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23F/c1-11-9-15(10-12(2)13(11)3)14-5-7-16(4,17)8-6-14/h9-10,14H,5-8H2,1-4H3.
What are the key properties of 5-(4-fluoro-4-methylcyclohexyl)-1,2,3-trimethylbenzene?
5-(4-fluoro-4-methylcyclohexyl)-1,2,3-trimethylbenzene has a molecular weight of 234.36 g/mol, XLogP of 5.00, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-fluoro-4-methylcyclohexyl)-1,2,3-trimethylbenzene is sourced from PubChem (CID 163550407), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).