C12H28N2 — CID 163550671
(2S)-5-N,5-dimethyl-2-N-propylheptane-2,5-diamine (PubChem CID 163550671) has the molecular formula C12H28N2 and a molecular weight of 200.37 g/mol. Its IUPAC name is (2S)-5-N,5-dimethyl-2-N-propylheptane-2,5-diamine.
| Compound Name | (2S)-5-N,5-dimethyl-2-N-propylheptane-2,5-diamine |
|---|---|
| PubChem CID | 163550671 |
| Molecular Formula | C12H28N2 |
| Molecular Weight | 200.37 g/mol |
| Exact Mass | 200.23 |
| IUPAC Name | (2S)-5-N,5-dimethyl-2-N-propylheptane-2,5-diamine |
| SMILES | CCCN[C@@H](C)CCC(C)(CC)NC |
| InChI | InChI=1S/C12H28N2/c1-6-10-14-11(3)8-9-12(4,7-2)13-5/h11,13-14H,6-10H2,1-5H3/t11-,12?/m0/s1 |
| InChIKey | FIUGRRDSAJBIJD-PXYINDEMSA-N |
| XLogP | 2.54 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.37 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |